C26H34N4O5S — CID 129023350
tert-butyl N-[[3-amino-5-[4-(1,3-dioxoisoindol-2-yl)butyl-methylamino]phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 129023350) has the molecular formula C26H34N4O5S and a molecular weight of 514.65 g/mol. Its IUPAC name is tert-butyl N-[[3-amino-5-[4-(1,3-dioxoisoindol-2-yl)butyl-methylamino]phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[[3-amino-5-[4-(1,3-dioxoisoindol-2-yl)butyl-methylamino]phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 129023350 |
| Molecular Formula | C26H34N4O5S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | tert-butyl N-[[3-amino-5-[4-(1,3-dioxoisoindol-2-yl)butyl-methylamino]phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CN(CCCCN1C(=O)c2ccccc2C1=O)c1cc(N)cc(CS(C)(=O)=NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H34N4O5S/c1-26(2,3)35-25(33)28-36(5,34)17-18-14-19(27)16-20(15-18)29(4)12-8-9-13-30-23(31)21-10-6-7-11-22(21)24(30)32/h6-7,10-11,14-16H,8-9,12-13,17,27H2,1-5H3 |
| InChIKey | OXXKHDIPBTXPDJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|