C31H45N3O8 — CID 90295682
methyl (1R,23S)-23-tert-butyl-18,18-dimethyl-3,21,24-trioxo-2,13,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10-triene-26-carboxylate (PubChem CID 90295682) has the molecular formula C31H45N3O8 and a molecular weight of 587.71 g/mol. Its IUPAC name is methyl (1R,23S)-23-tert-butyl-18,18-dimethyl-3,21,24-trioxo-2,13,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10-triene-26-carboxylate.
| Compound Name | methyl (1R,23S)-23-tert-butyl-18,18-dimethyl-3,21,24-trioxo-2,13,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10-triene-26-carboxylate |
|---|---|
| PubChem CID | 90295682 |
| Molecular Formula | C31H45N3O8 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | methyl (1R,23S)-23-tert-butyl-18,18-dimethyl-3,21,24-trioxo-2,13,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10-triene-26-carboxylate |
| SMILES | COC(=O)C1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCC(C)(C)CCCCOCc1cccc3c1CN(C3)C(=O)O2 |
| InChI | InChI=1S/C31H45N3O8/c1-30(2,3)25-26(35)34-16-22(14-24(34)27(36)39-6)42-29(38)33-15-20-10-9-11-21(23(20)17-33)18-40-13-8-7-12-31(4,5)19-41-28(37)32-25/h9-11,22,24-25H,7-8,12-19H2,1-6H3,(H,32,37)/t22-,24?,25-/m1/s1 |
| InChIKey | YORPWOFZVCXBRE-HADLQSQHSA-N |
| XLogP | 4.15 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|