C16H15FIN3O — CID 90298981
1-(2,6-dimethylphenyl)-3-[(E)-(4-fluoro-2-iodophenyl)methylideneamino]urea (PubChem CID 90298981) has the molecular formula C16H15FIN3O and a molecular weight of 411.22 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-(4-fluoro-2-iodophenyl)methylideneamino]urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-(4-fluoro-2-iodophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 90298981 |
| Molecular Formula | C16H15FIN3O |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-(4-fluoro-2-iodophenyl)methylideneamino]urea |
| SMILES | Cc1cccc(C)c1NC(=O)N/N=C/c1ccc(F)cc1I |
| InChI | InChI=1S/C16H15FIN3O/c1-10-4-3-5-11(2)15(10)20-16(22)21-19-9-12-6-7-13(17)8-14(12)18/h3-9H,1-2H3,(H2,20,21,22)/b19-9+ |
| InChIKey | WTTPXPKMBKRGRC-DJKKODMXSA-N |
| XLogP | 4.20 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|