C15H14N2O2 — CID 90300083
2-benzyl-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione (PubChem CID 90300083) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-benzyl-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione.
| Compound Name | 2-benzyl-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
|---|---|
| PubChem CID | 90300083 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-benzyl-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
| SMILES | O=C1c2cccc(=O)n2CCN1Cc1ccccc1 |
| InChI | InChI=1S/C15H14N2O2/c18-14-8-4-7-13-15(19)16(9-10-17(13)14)11-12-5-2-1-3-6-12/h1-8H,9-11H2 |
| InChIKey | NDQWWWRSUUOUFP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |