C18H23ClN2O4S — CID 9030613
N-[5-chloro-2-(dimethylamino)phenyl]-3,4-diethoxybenzenesulfonamide (PubChem CID 9030613) has the molecular formula C18H23ClN2O4S and a molecular weight of 398.91 g/mol. Its IUPAC name is N-[5-chloro-2-(dimethylamino)phenyl]-3,4-diethoxybenzenesulfonamide.
| Compound Name | N-[5-chloro-2-(dimethylamino)phenyl]-3,4-diethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 9030613 |
| Molecular Formula | C18H23ClN2O4S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[5-chloro-2-(dimethylamino)phenyl]-3,4-diethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(Cl)ccc2N(C)C)cc1OCC |
| InChI | InChI=1S/C18H23ClN2O4S/c1-5-24-17-10-8-14(12-18(17)25-6-2)26(22,23)20-15-11-13(19)7-9-16(15)21(3)4/h7-12,20H,5-6H2,1-4H3 |
| InChIKey | RRCDKXUIRFIKRA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |