C20H15FN4O2S — CID 90313101
3-amino-6-[4-(2-cyclopropylsulfonylphenyl)-2-fluorophenyl]pyrazine-2-carbonitrile (PubChem CID 90313101) has the molecular formula C20H15FN4O2S and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-amino-6-[4-(2-cyclopropylsulfonylphenyl)-2-fluorophenyl]pyrazine-2-carbonitrile.
| Compound Name | 3-amino-6-[4-(2-cyclopropylsulfonylphenyl)-2-fluorophenyl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 90313101 |
| Molecular Formula | C20H15FN4O2S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-amino-6-[4-(2-cyclopropylsulfonylphenyl)-2-fluorophenyl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nc(-c2ccc(-c3ccccc3S(=O)(=O)C3CC3)cc2F)cnc1N |
| InChI | InChI=1S/C20H15FN4O2S/c21-16-9-12(5-8-15(16)18-11-24-20(23)17(10-22)25-18)14-3-1-2-4-19(14)28(26,27)13-6-7-13/h1-5,8-9,11,13H,6-7H2,(H2,23,24) |
| InChIKey | DQRPTBDUPMAGMN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |