C25H21FN4OS — CID 90313750
N-[2-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfanylethyl]benzamide (PubChem CID 90313750) has the molecular formula C25H21FN4OS and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[2-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfanylethyl]benzamide.
| Compound Name | N-[2-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfanylethyl]benzamide |
|---|---|
| PubChem CID | 90313750 |
| Molecular Formula | C25H21FN4OS |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[2-[2-[4-(2-aminopyrimidin-5-yl)-3-fluorophenyl]phenyl]sulfanylethyl]benzamide |
| SMILES | Nc1ncc(-c2ccc(-c3ccccc3SCCNC(=O)c3ccccc3)cc2F)cn1 |
| InChI | InChI=1S/C25H21FN4OS/c26-22-14-18(10-11-20(22)19-15-29-25(27)30-16-19)21-8-4-5-9-23(21)32-13-12-28-24(31)17-6-2-1-3-7-17/h1-11,14-16H,12-13H2,(H,28,31)(H2,27,29,30) |
| InChIKey | UZWKTQONYRPFDS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|