C15H17IN2OS — CID 90315986
1-(5-iodonaphthalen-1-yl)sulfinyl-1,4-diazepane (PubChem CID 90315986) has the molecular formula C15H17IN2OS and a molecular weight of 400.29 g/mol. Its IUPAC name is 1-(5-iodonaphthalen-1-yl)sulfinyl-1,4-diazepane.
| Compound Name | 1-(5-iodonaphthalen-1-yl)sulfinyl-1,4-diazepane |
|---|---|
| PubChem CID | 90315986 |
| Molecular Formula | C15H17IN2OS |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 1-(5-iodonaphthalen-1-yl)sulfinyl-1,4-diazepane |
| SMILES | O=S(c1cccc2c(I)cccc12)N1CCCNCC1 |
| InChI | InChI=1S/C15H17IN2OS/c16-14-6-1-5-13-12(14)4-2-7-15(13)20(19)18-10-3-8-17-9-11-18/h1-2,4-7,17H,3,8-11H2 |
| InChIKey | XVRDUDJKNJQFNS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|