C16H22N2OS — CID 166902751
1-[2,3-bis[(Z)-prop-1-enyl]phenyl]sulfinyl-1,3-diazinane (PubChem CID 166902751) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-[2,3-bis[(Z)-prop-1-enyl]phenyl]sulfinyl-1,3-diazinane.
| Compound Name | 1-[2,3-bis[(Z)-prop-1-enyl]phenyl]sulfinyl-1,3-diazinane |
|---|---|
| PubChem CID | 166902751 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-[2,3-bis[(Z)-prop-1-enyl]phenyl]sulfinyl-1,3-diazinane |
| SMILES | C/C=C\c1cccc(S(=O)N2CCCNC2)c1/C=C\C |
| InChI | InChI=1S/C16H22N2OS/c1-3-7-14-9-5-10-16(15(14)8-4-2)20(19)18-12-6-11-17-13-18/h3-5,7-10,17H,6,11-13H2,1-2H3/b7-3-,8-4- |
| InChIKey | BIUABLRUWWMGLD-VHOZIDCHSA-N |
| XLogP | 3.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |