C35H29F10NO4 — CID 90317171
4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-fluorophenyl]-3-(trifluoromethyl)benzoic acid (PubChem CID 90317171) has the molecular formula C35H29F10NO4 and a molecular weight of 717.60 g/mol. Its IUPAC name is 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-fluorophenyl]-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-fluorophenyl]-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 90317171 |
| Molecular Formula | C35H29F10NO4 |
| Molecular Weight | 717.60 g/mol |
| Exact Mass | 717.19 |
| IUPAC Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-fluorophenyl]-3-(trifluoromethyl)benzoic acid |
| SMILES | C[C@H]1[C@H](OC(=O)N1CC2=C(CCC(C2)(C)C)C3=CC(=C(C=C3)F)C4=C(C=C(C=C4)C(=O)O)C(F)(F)F)C5=CC(=CC(=C5)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C35H29F10NO4/c1-17-29(20-10-22(33(37,38)39)14-23(11-20)34(40,41)42)50-31(49)46(17)16-21-15-32(2,3)9-8-24(21)18-5-7-28(36)26(12-18)25-6-4-19(30(47)48)13-27(25)35(43,44)45/h4-7,10-14,17,29H,8-9,15-16H2,1-3H3,(H,47,48)/t17-,29-/m0/s1 |
| InChIKey | ZPOQGCOUNZOHRF-ADKRDUOOSA-N |
| XLogP | 9.20 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | 1270 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.60 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |