About 5-propylnonan-2-yl carbamate
5-propylnonan-2-yl carbamate (PubChem CID 90320212) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is 5-propylnonan-2-yl carbamate.
Molecular Properties
| Compound Name | 5-propylnonan-2-yl carbamate |
| PubChem CID | 90320212 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 5-propylnonan-2-yl carbamate |
| SMILES | CCCCC(CCC)CCC(C)OC(N)=O |
| InChI | InChI=1S/C13H27NO2/c1-4-6-8-12(7-5-2)10-9-11(3)16-13(14)15/h11-12H,4-10H2,1-3H3,(H2,14,15) |
| InChIKey | BKCQTKVGKSBYAB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propylnonan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propylnonan-2-yl carbamate?
The IUPAC name of 5-propylnonan-2-yl carbamate (CID 90320212) is 5-propylnonan-2-yl carbamate.
What is the SMILES notation for 5-propylnonan-2-yl carbamate?
The canonical SMILES for 5-propylnonan-2-yl carbamate is CCCCC(CCC)CCC(C)OC(N)=O.
What is the InChIKey of 5-propylnonan-2-yl carbamate?
The InChIKey is BKCQTKVGKSBYAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-4-6-8-12(7-5-2)10-9-11(3)16-13(14)15/h11-12H,4-10H2,1-3H3,(H2,14,15).
What are the key properties of 5-propylnonan-2-yl carbamate?
5-propylnonan-2-yl carbamate has a molecular weight of 229.36 g/mol, XLogP of 3.86, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propylnonan-2-yl carbamate is sourced from PubChem (CID 90320212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).