About [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide
[1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide (PubChem CID 90322153) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide.
Molecular Properties
| Compound Name | [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide |
| PubChem CID | 90322153 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide |
| SMILES | CC(C)(C)/C(=N/C#N)N1CCC1 |
| InChI | InChI=1S/C9H15N3/c1-9(2,3)8(11-7-10)12-5-4-6-12/h4-6H2,1-3H3/b11-8- |
| InChIKey | LNPGBJXNRXHKPA-FLIBITNWSA-N |
| XLogP | 1.62 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide?
The IUPAC name of [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide (CID 90322153) is [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide.
What is the SMILES notation for [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide?
The canonical SMILES for [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide is CC(C)(C)/C(=N/C#N)N1CCC1.
What is the InChIKey of [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide?
The InChIKey is LNPGBJXNRXHKPA-FLIBITNWSA-N. The full InChI is InChI=1S/C9H15N3/c1-9(2,3)8(11-7-10)12-5-4-6-12/h4-6H2,1-3H3/b11-8-.
What are the key properties of [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide?
[1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide has a molecular weight of 165.24 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(azetidin-1-yl)-2,2-dimethylpropylidene]cyanamide is sourced from PubChem (CID 90322153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).