C10H18N4OS — CID 107223071
methyl N-cyano-4-(2-hydroxyethyl)-1,4-diazepane-1-carboximidothioate (PubChem CID 107223071) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is methyl N-cyano-4-(2-hydroxyethyl)-1,4-diazepane-1-carboximidothioate.
| Compound Name | methyl N-cyano-4-(2-hydroxyethyl)-1,4-diazepane-1-carboximidothioate |
|---|---|
| PubChem CID | 107223071 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | methyl N-cyano-4-(2-hydroxyethyl)-1,4-diazepane-1-carboximidothioate |
| SMILES | CS/C(=N\C#N)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C10H18N4OS/c1-16-10(12-9-11)14-4-2-3-13(5-6-14)7-8-15/h15H,2-8H2,1H3/b12-10- |
| InChIKey | UBFQFKSYWAUVKE-BENRWUELSA-N |
| XLogP | 0.19 |
| TPSA | 62.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|