About N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide
N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide (PubChem CID 91801508) has the molecular formula C9H15N5
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide |
| PubChem CID | 91801508 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide |
| SMILES | N#C/N=C(/NN1CCC1)N1CCCC1 |
| InChI | InChI=1S/C9H15N5/c10-8-11-9(12-14-6-3-7-14)13-4-1-2-5-13/h1-7H2,(H,11,12) |
| InChIKey | ACINEGDVLSOLPS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide?
The IUPAC name of N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide (CID 91801508) is N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide.
What is the SMILES notation for N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide?
The canonical SMILES for N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide is N#C/N=C(/NN1CCC1)N1CCCC1.
What is the InChIKey of N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide?
The InChIKey is ACINEGDVLSOLPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5/c10-8-11-9(12-14-6-3-7-14)13-4-1-2-5-13/h1-7H2,(H,11,12).
What are the key properties of N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide?
N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide has a molecular weight of 193.25 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-1-yl)-N'-cyanopyrrolidine-1-carboximidamide is sourced from PubChem (CID 91801508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).