C16H11BrN4O — CID 90326288
5-(1-bromoethyl)-3-[5-(2-pyridin-2-ylethynyl)-2-pyridinyl]-1,2,4-oxadiazole (PubChem CID 90326288) has the molecular formula C16H11BrN4O and a molecular weight of 355.20 g/mol. Its IUPAC name is 5-(1-bromoethyl)-3-[5-(2-pyridin-2-ylethynyl)-2-pyridinyl]-1,2,4-oxadiazole.
| Compound Name | 5-(1-bromoethyl)-3-[5-(2-pyridin-2-ylethynyl)-2-pyridinyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 90326288 |
| Molecular Formula | C16H11BrN4O |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 5-(1-bromoethyl)-3-[5-(2-pyridin-2-ylethynyl)-2-pyridinyl]-1,2,4-oxadiazole |
| SMILES | CC(Br)c1nc(-c2ccc(C#Cc3ccccn3)cn2)no1 |
| InChI | InChI=1S/C16H11BrN4O/c1-11(17)16-20-15(21-22-16)14-8-6-12(10-19-14)5-7-13-4-2-3-9-18-13/h2-4,6,8-11H,1H3 |
| InChIKey | YTLDKRXIKQSFOB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|