C16H24O2 — CID 90326782
propan-2-yl 5-(4-methylpent-3-enyl)cyclohexa-1,4-diene-1-carboxylate (PubChem CID 90326782) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is propan-2-yl 5-(4-methylpent-3-enyl)cyclohexa-1,4-diene-1-carboxylate.
| Compound Name | propan-2-yl 5-(4-methylpent-3-enyl)cyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 90326782 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | propan-2-yl 5-(4-methylpent-3-enyl)cyclohexa-1,4-diene-1-carboxylate |
| SMILES | CC(C)=CCCC1=CCC=C(C(=O)OC(C)C)C1 |
| InChI | InChI=1S/C16H24O2/c1-12(2)7-5-8-14-9-6-10-15(11-14)16(17)18-13(3)4/h7,9-10,13H,5-6,8,11H2,1-4H3 |
| InChIKey | LCRHUTVDFOXOSV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|