C7H12F5NO6S3 — CID 90329011
N-butyl-1,1-difluoro-1-(trifluoromethylsulfonylmethylsulfonyl)methanesulfonamide (PubChem CID 90329011) has the molecular formula C7H12F5NO6S3 and a molecular weight of 397.37 g/mol. Its IUPAC name is N-butyl-1,1-difluoro-1-(trifluoromethylsulfonylmethylsulfonyl)methanesulfonamide.
| Compound Name | N-butyl-1,1-difluoro-1-(trifluoromethylsulfonylmethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 90329011 |
| Molecular Formula | C7H12F5NO6S3 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | N-butyl-1,1-difluoro-1-(trifluoromethylsulfonylmethylsulfonyl)methanesulfonamide |
| SMILES | CCCCNS(=O)(=O)C(F)(F)S(=O)(=O)CS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H12F5NO6S3/c1-2-3-4-13-22(18,19)7(11,12)21(16,17)5-20(14,15)6(8,9)10/h13H,2-5H2,1H3 |
| InChIKey | APSYXGOHPOHBTO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|