C17H16FN5O3S — CID 90329774
2-[6-(2-aminopyrimidin-5-yl)-5-fluoro-3-pyridinyl]-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 90329774) has the molecular formula C17H16FN5O3S and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-[6-(2-aminopyrimidin-5-yl)-5-fluoro-3-pyridinyl]-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 2-[6-(2-aminopyrimidin-5-yl)-5-fluoro-3-pyridinyl]-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90329774 |
| Molecular Formula | C17H16FN5O3S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-[6-(2-aminopyrimidin-5-yl)-5-fluoro-3-pyridinyl]-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | Nc1ncc(-c2ncc(-c3ccccc3S(=O)(=O)NCCO)cc2F)cn1 |
| InChI | InChI=1S/C17H16FN5O3S/c18-14-7-11(8-20-16(14)12-9-21-17(19)22-10-12)13-3-1-2-4-15(13)27(25,26)23-5-6-24/h1-4,7-10,23-24H,5-6H2,(H2,19,21,22) |
| InChIKey | MEDVLOPNRNXMDO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |