C23H21FN4O3 — CID 90331277
2-(4-fluoro-2-methylanilino)-4-[2-(3-methylbut-2-enoyl)phenoxy]pyrimidine-5-carboxamide (PubChem CID 90331277) has the molecular formula C23H21FN4O3 and a molecular weight of 420.44 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylanilino)-4-[2-(3-methylbut-2-enoyl)phenoxy]pyrimidine-5-carboxamide.
| Compound Name | 2-(4-fluoro-2-methylanilino)-4-[2-(3-methylbut-2-enoyl)phenoxy]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90331277 |
| Molecular Formula | C23H21FN4O3 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-(4-fluoro-2-methylanilino)-4-[2-(3-methylbut-2-enoyl)phenoxy]pyrimidine-5-carboxamide |
| SMILES | CC(C)=CC(=O)c1ccccc1Oc1nc(Nc2ccc(F)cc2C)ncc1C(N)=O |
| InChI | InChI=1S/C23H21FN4O3/c1-13(2)10-19(29)16-6-4-5-7-20(16)31-22-17(21(25)30)12-26-23(28-22)27-18-9-8-15(24)11-14(18)3/h4-12H,1-3H3,(H2,25,30)(H,26,27,28) |
| InChIKey | XRZZTPWCIPAFSM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|