C15H10N6O2 — CID 90332158
6-nitro-2-[4-(triazol-1-yl)phenyl]imidazo[1,2-a]pyridine (PubChem CID 90332158) has the molecular formula C15H10N6O2 and a molecular weight of 306.29 g/mol. Its IUPAC name is 6-nitro-2-[4-(triazol-1-yl)phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 6-nitro-2-[4-(triazol-1-yl)phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 90332158 |
| Molecular Formula | C15H10N6O2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 6-nitro-2-[4-(triazol-1-yl)phenyl]imidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3ccc(-n4ccnn4)cc3)cn2c1 |
| InChI | InChI=1S/C15H10N6O2/c22-21(23)13-5-6-15-17-14(10-19(15)9-13)11-1-3-12(4-2-11)20-8-7-16-18-20/h1-10H |
| InChIKey | GRXYRVHZIKJENM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|