C22H22F2N4O4S — CID 90332941
3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propyl N-(2,6-difluoro-4-nitrophenyl)carbamate (PubChem CID 90332941) has the molecular formula C22H22F2N4O4S and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propyl N-(2,6-difluoro-4-nitrophenyl)carbamate.
| Compound Name | 3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propyl N-(2,6-difluoro-4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 90332941 |
| Molecular Formula | C22H22F2N4O4S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]propyl N-(2,6-difluoro-4-nitrophenyl)carbamate |
| SMILES | O=C(Nc1c(F)cc([N+](=O)[O-])cc1F)OCCCN1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C22H22F2N4O4S/c23-16-12-15(28(30)31)13-17(24)20(16)26-22(29)32-11-3-8-27-9-6-14(7-10-27)21-25-18-4-1-2-5-19(18)33-21/h1-2,4-5,12-14H,3,6-11H2,(H,26,29) |
| InChIKey | KNWQDOXVZLHTHZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|