C21H23F2N5O3 — CID 78426824
3-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2,6-difluorophenyl)carbamate (PubChem CID 78426824) has the molecular formula C21H23F2N5O3 and a molecular weight of 431.44 g/mol. Its IUPAC name is 3-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2,6-difluorophenyl)carbamate.
| Compound Name | 3-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2,6-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 78426824 |
| Molecular Formula | C21H23F2N5O3 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 3-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2,6-difluorophenyl)carbamate |
| SMILES | Nc1cc(F)c(NC(=O)OCCCN2CCN(c3nc4ccccc4o3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H23F2N5O3/c22-15-12-14(24)13-16(23)19(15)26-21(29)30-11-3-6-27-7-9-28(10-8-27)20-25-17-4-1-2-5-18(17)31-20/h1-2,4-5,12-13H,3,6-11,24H2,(H,26,29) |
| InChIKey | BEWOPSRBGFICPB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|