C12H16N5O6+ — CID 90334372
[(2,4-dinitrophenoxy)amino]-(1-methylpiperidin-4-yl)-oxoazanium (PubChem CID 90334372) has the molecular formula C12H16N5O6+ and a molecular weight of 326.29 g/mol. Its IUPAC name is [(2,4-dinitrophenoxy)amino]-(1-methylpiperidin-4-yl)-oxoazanium.
| Compound Name | [(2,4-dinitrophenoxy)amino]-(1-methylpiperidin-4-yl)-oxoazanium |
|---|---|
| PubChem CID | 90334372 |
| Molecular Formula | C12H16N5O6+ |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [(2,4-dinitrophenoxy)amino]-(1-methylpiperidin-4-yl)-oxoazanium |
| SMILES | CN1CCC([N+](=O)NOc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H16N5O6/c1-14-6-4-9(5-7-14)15(18)13-23-12-3-2-10(16(19)20)8-11(12)17(21)22/h2-3,8-9H,4-7H2,1H3,(H,13,18)/q+1 |
| InChIKey | YOMHFYKAYWTXQD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|