C8H17NOS — CID 90335980
(3S,4R)-3-(ethylamino)-4-methyl-5-sulfanylpentan-2-one (PubChem CID 90335980) has the molecular formula C8H17NOS and a molecular weight of 175.30 g/mol. Its IUPAC name is (3S,4R)-3-(ethylamino)-4-methyl-5-sulfanylpentan-2-one.
| Compound Name | (3S,4R)-3-(ethylamino)-4-methyl-5-sulfanylpentan-2-one |
|---|---|
| PubChem CID | 90335980 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (3S,4R)-3-(ethylamino)-4-methyl-5-sulfanylpentan-2-one |
| SMILES | CCN[C@H](C(C)=O)[C@@H](C)CS |
| InChI | InChI=1S/C8H17NOS/c1-4-9-8(7(3)10)6(2)5-11/h6,8-9,11H,4-5H2,1-3H3/t6-,8-/m0/s1 |
| InChIKey | NLEHAMNIVPDYTA-XPUUQOCRSA-N |
| XLogP | 1.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|