C10H20N2O2S2 — CID 90335935
(3S,4R)-3-[[(3R)-3-amino-2-oxo-4-sulfanylbutyl]amino]-4-methyl-5-sulfanylpentan-2-one (PubChem CID 90335935) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is (3S,4R)-3-[[(3R)-3-amino-2-oxo-4-sulfanylbutyl]amino]-4-methyl-5-sulfanylpentan-2-one.
| Compound Name | (3S,4R)-3-[[(3R)-3-amino-2-oxo-4-sulfanylbutyl]amino]-4-methyl-5-sulfanylpentan-2-one |
|---|---|
| PubChem CID | 90335935 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (3S,4R)-3-[[(3R)-3-amino-2-oxo-4-sulfanylbutyl]amino]-4-methyl-5-sulfanylpentan-2-one |
| SMILES | CC(=O)[C@@H](NCC(=O)[C@@H](N)CS)[C@@H](C)CS |
| InChI | InChI=1S/C10H20N2O2S2/c1-6(4-15)10(7(2)13)12-3-9(14)8(11)5-16/h6,8,10,12,15-16H,3-5,11H2,1-2H3/t6-,8-,10-/m0/s1 |
| InChIKey | WCSZPOGIGADPEK-HKPALBBZSA-N |
| XLogP | -0.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|