C11H17NO2P2 — CID 90337933
3-(diphosphanylamino)-4-(4-methylphenyl)butanoic acid (PubChem CID 90337933) has the molecular formula C11H17NO2P2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 3-(diphosphanylamino)-4-(4-methylphenyl)butanoic acid.
| Compound Name | 3-(diphosphanylamino)-4-(4-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 90337933 |
| Molecular Formula | C11H17NO2P2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-(diphosphanylamino)-4-(4-methylphenyl)butanoic acid |
| SMILES | Cc1ccc(CC(CC(=O)O)NPP)cc1 |
| InChI | InChI=1S/C11H17NO2P2/c1-8-2-4-9(5-3-8)6-10(12-16-15)7-11(13)14/h2-5,10,12,16H,6-7,15H2,1H3,(H,13,14) |
| InChIKey | CTDYYDLHVFTQLM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|