C32H28N4O6 — CID 90339441
1-[1-[9,10-dioxo-8-[1-(phenylcarbamoylamino)ethoxy]anthracen-1-yl]oxyethyl]-3-phenylurea (PubChem CID 90339441) has the molecular formula C32H28N4O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is 1-[1-[9,10-dioxo-8-[1-(phenylcarbamoylamino)ethoxy]anthracen-1-yl]oxyethyl]-3-phenylurea.
| Compound Name | 1-[1-[9,10-dioxo-8-[1-(phenylcarbamoylamino)ethoxy]anthracen-1-yl]oxyethyl]-3-phenylurea |
|---|---|
| PubChem CID | 90339441 |
| Molecular Formula | C32H28N4O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 1-[1-[9,10-dioxo-8-[1-(phenylcarbamoylamino)ethoxy]anthracen-1-yl]oxyethyl]-3-phenylurea |
| SMILES | CC(NC(=O)Nc1ccccc1)Oc1cccc2c1C(=O)c1c(OC(C)NC(=O)Nc3ccccc3)cccc1C2=O |
| InChI | InChI=1S/C32H28N4O6/c1-19(33-31(39)35-21-11-5-3-6-12-21)41-25-17-9-15-23-27(25)30(38)28-24(29(23)37)16-10-18-26(28)42-20(2)34-32(40)36-22-13-7-4-8-14-22/h3-20H,1-2H3,(H2,33,35,39)(H2,34,36,40) |
| InChIKey | WLPDSXZPFOVCOF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|