C27H27N3O5S2 — CID 90340211
[3-hydroxy-2-[[2-[(1E,3E)-4-[6-(methylamino)-3-pyridinyl]buta-1,3-dienyl]-1,3-benzothiazol-6-yl]oxy]propyl] 4-methylbenzenesulfonate (PubChem CID 90340211) has the molecular formula C27H27N3O5S2 and a molecular weight of 537.66 g/mol. Its IUPAC name is [3-hydroxy-2-[[2-[(1E,3E)-4-[6-(methylamino)-3-pyridinyl]buta-1,3-dienyl]-1,3-benzothiazol-6-yl]oxy]propyl] 4-methylbenzenesulfonate.
| Compound Name | [3-hydroxy-2-[[2-[(1E,3E)-4-[6-(methylamino)-3-pyridinyl]buta-1,3-dienyl]-1,3-benzothiazol-6-yl]oxy]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90340211 |
| Molecular Formula | C27H27N3O5S2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | [3-hydroxy-2-[[2-[(1E,3E)-4-[6-(methylamino)-3-pyridinyl]buta-1,3-dienyl]-1,3-benzothiazol-6-yl]oxy]propyl] 4-methylbenzenesulfonate |
| SMILES | CNc1ccc(/C=C/C=C/c2nc3ccc(OC(CO)COS(=O)(=O)c4ccc(C)cc4)cc3s2)cn1 |
| InChI | InChI=1S/C27H27N3O5S2/c1-19-7-11-23(12-8-19)37(32,33)34-18-22(17-31)35-21-10-13-24-25(15-21)36-27(30-24)6-4-3-5-20-9-14-26(28-2)29-16-20/h3-16,22,31H,17-18H2,1-2H3,(H,28,29)/b5-3+,6-4+ |
| InChIKey | RVAGKBHXUNWDIF-GGWOSOGESA-N |
| XLogP | 4.91 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|