C31H37N5O5S2Si — CID 169159833
[2-[tert-butyl(dimethyl)silyl]oxy-3-[[2-[(E)-4-[5-(methylamino)pyrazin-2-yl]but-1-en-3-ynyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]oxy]propyl] 4-methylbenzenesulfonate (PubChem CID 169159833) has the molecular formula C31H37N5O5S2Si and a molecular weight of 651.89 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-3-[[2-[(E)-4-[5-(methylamino)pyrazin-2-yl]but-1-en-3-ynyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]oxy]propyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-3-[[2-[(E)-4-[5-(methylamino)pyrazin-2-yl]but-1-en-3-ynyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]oxy]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169159833 |
| Molecular Formula | C31H37N5O5S2Si |
| Molecular Weight | 651.89 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-3-[[2-[(E)-4-[5-(methylamino)pyrazin-2-yl]but-1-en-3-ynyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]oxy]propyl] 4-methylbenzenesulfonate |
| SMILES | CNc1cnc(C#C/C=C/c2nc3ccc(OCC(COS(=O)(=O)c4ccc(C)cc4)O[Si](C)(C)C(C)(C)C)nc3s2)cn1 |
| InChI | InChI=1S/C31H37N5O5S2Si/c1-22-12-14-25(15-13-22)43(37,38)40-21-24(41-44(6,7)31(2,3)4)20-39-28-17-16-26-30(36-28)42-29(35-26)11-9-8-10-23-18-34-27(32-5)19-33-23/h9,11-19,24H,20-21H2,1-7H3,(H,32,34)/b11-9+ |
| InChIKey | GCDWLGJDPGONPP-PKNBQFBNSA-N |
| XLogP | 6.07 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.89 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|