C21H28F3N3O3S — CID 90346782
(2E,4Z)-4-(2-amino-1,1,1-trifluoro-3-methylbutan-2-yl)-N-[[4-(methanesulfonamido)-3-methylphenyl]methyl]hepta-2,4,6-trienamide (PubChem CID 90346782) has the molecular formula C21H28F3N3O3S and a molecular weight of 459.53 g/mol. Its IUPAC name is (2E,4Z)-4-(2-amino-1,1,1-trifluoro-3-methylbutan-2-yl)-N-[[4-(methanesulfonamido)-3-methylphenyl]methyl]hepta-2,4,6-trienamide.
| Compound Name | (2E,4Z)-4-(2-amino-1,1,1-trifluoro-3-methylbutan-2-yl)-N-[[4-(methanesulfonamido)-3-methylphenyl]methyl]hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 90346782 |
| Molecular Formula | C21H28F3N3O3S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (2E,4Z)-4-(2-amino-1,1,1-trifluoro-3-methylbutan-2-yl)-N-[[4-(methanesulfonamido)-3-methylphenyl]methyl]hepta-2,4,6-trienamide |
| SMILES | C=C/C=C(/C=C/C(=O)NCc1ccc(NS(C)(=O)=O)c(C)c1)C(N)(C(C)C)C(F)(F)F |
| InChI | InChI=1S/C21H28F3N3O3S/c1-6-7-17(20(25,14(2)3)21(22,23)24)9-11-19(28)26-13-16-8-10-18(15(4)12-16)27-31(5,29)30/h6-12,14,27H,1,13,25H2,2-5H3,(H,26,28)/b11-9+,17-7- |
| InChIKey | ICCZCHDPGGADKE-LVGOETLESA-N |
| XLogP | 3.57 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|