C13H14ClFN2O — CID 90349633
N-(2-chloro-3-methylcyclohex-2-en-1-yl)-2-fluoropyridine-4-carboxamide (PubChem CID 90349633) has the molecular formula C13H14ClFN2O and a molecular weight of 268.72 g/mol. Its IUPAC name is N-(2-chloro-3-methylcyclohex-2-en-1-yl)-2-fluoropyridine-4-carboxamide.
| Compound Name | N-(2-chloro-3-methylcyclohex-2-en-1-yl)-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 90349633 |
| Molecular Formula | C13H14ClFN2O |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(2-chloro-3-methylcyclohex-2-en-1-yl)-2-fluoropyridine-4-carboxamide |
| SMILES | CC1=C(Cl)C(NC(=O)c2ccnc(F)c2)CCC1 |
| InChI | InChI=1S/C13H14ClFN2O/c1-8-3-2-4-10(12(8)14)17-13(18)9-5-6-16-11(15)7-9/h5-7,10H,2-4H2,1H3,(H,17,18) |
| InChIKey | NQVWCCAQFDCCBU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|