C17H24F5N3O — CID 90352083
N-[1,1,1,3,3-pentafluoro-2-[(4-methylpiperazin-1-yl)methyl]butan-2-yl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 90352083) has the molecular formula C17H24F5N3O and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[1,1,1,3,3-pentafluoro-2-[(4-methylpiperazin-1-yl)methyl]butan-2-yl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N-[1,1,1,3,3-pentafluoro-2-[(4-methylpiperazin-1-yl)methyl]butan-2-yl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 90352083 |
| Molecular Formula | C17H24F5N3O |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[1,1,1,3,3-pentafluoro-2-[(4-methylpiperazin-1-yl)methyl]butan-2-yl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | CN1CCN(CC(NC(=O)C2=CCCC=C2)(C(C)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H24F5N3O/c1-15(18,19)16(17(20,21)22,12-25-10-8-24(2)9-11-25)23-14(26)13-6-4-3-5-7-13/h4,6-7H,3,5,8-12H2,1-2H3,(H,23,26) |
| InChIKey | HTGXGACGWAAXKF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |