C17H12N2O4S2 — CID 9035834
2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(2-nitrophenyl)ethenyl]sulfanylacetic acid (PubChem CID 9035834) has the molecular formula C17H12N2O4S2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(2-nitrophenyl)ethenyl]sulfanylacetic acid.
| Compound Name | 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(2-nitrophenyl)ethenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 9035834 |
| Molecular Formula | C17H12N2O4S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(2-nitrophenyl)ethenyl]sulfanylacetic acid |
| SMILES | O=C(O)CS/C(=C\c1ccccc1[N+](=O)[O-])c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H12N2O4S2/c20-16(21)10-24-15(9-11-5-1-3-7-13(11)19(22)23)17-18-12-6-2-4-8-14(12)25-17/h1-9H,10H2,(H,20,21)/b15-9- |
| InChIKey | MWKSLGDOQGNENP-DHDCSXOGSA-N |
| XLogP | 4.52 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|