C21H24FN5O2S — CID 90359480
(3S,4S,6S,8R,26S)-23-fluoro-13-oxa-9-thia-2,19,21,24-tetrazapentacyclo[18.3.1.13,6.114,18.04,8]hexacosa-1(24),14,16,18(25),20,22-hexaene-26-carboxamide (PubChem CID 90359480) has the molecular formula C21H24FN5O2S and a molecular weight of 429.52 g/mol. Its IUPAC name is (3S,4S,6S,8R,26S)-23-fluoro-13-oxa-9-thia-2,19,21,24-tetrazapentacyclo[18.3.1.13,6.114,18.04,8]hexacosa-1(24),14,16,18(25),20,22-hexaene-26-carboxamide.
| Compound Name | (3S,4S,6S,8R,26S)-23-fluoro-13-oxa-9-thia-2,19,21,24-tetrazapentacyclo[18.3.1.13,6.114,18.04,8]hexacosa-1(24),14,16,18(25),20,22-hexaene-26-carboxamide |
|---|---|
| PubChem CID | 90359480 |
| Molecular Formula | C21H24FN5O2S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (3S,4S,6S,8R,26S)-23-fluoro-13-oxa-9-thia-2,19,21,24-tetrazapentacyclo[18.3.1.13,6.114,18.04,8]hexacosa-1(24),14,16,18(25),20,22-hexaene-26-carboxamide |
| SMILES | NC(=O)[C@H]1[C@H]2C[C@H]3[C@@H]1Nc1nc(ncc1F)Nc1cccc(c1)OCCCS[C@@H]3C2 |
| InChI | InChI=1S/C21H24FN5O2S/c22-15-10-24-21-25-12-3-1-4-13(9-12)29-5-2-6-30-16-8-11-7-14(16)18(17(11)19(23)28)26-20(15)27-21/h1,3-4,9-11,14,16-18H,2,5-8H2,(H2,23,28)(H2,24,25,26,27)/t11-,14+,16+,17-,18-/m0/s1 |
| InChIKey | NTSVGXKJMCFSKE-DARGJBLHSA-N |
| XLogP | 3.17 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |