C22H26FN5O2 — CID 58531882
(3R,4R,6S,8R,25S)-22-fluoro-12-hydroxy-2,18,20,23-tetrazapentacyclo[17.3.1.13,6.113,17.04,8]pentacosa-1(23),13(24),14,16,19,21-hexaene-25-carboxamide (PubChem CID 58531882) has the molecular formula C22H26FN5O2 and a molecular weight of 411.48 g/mol. Its IUPAC name is (3R,4R,6S,8R,25S)-22-fluoro-12-hydroxy-2,18,20,23-tetrazapentacyclo[17.3.1.13,6.113,17.04,8]pentacosa-1(23),13(24),14,16,19,21-hexaene-25-carboxamide.
| Compound Name | (3R,4R,6S,8R,25S)-22-fluoro-12-hydroxy-2,18,20,23-tetrazapentacyclo[17.3.1.13,6.113,17.04,8]pentacosa-1(23),13(24),14,16,19,21-hexaene-25-carboxamide |
|---|---|
| PubChem CID | 58531882 |
| Molecular Formula | C22H26FN5O2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (3R,4R,6S,8R,25S)-22-fluoro-12-hydroxy-2,18,20,23-tetrazapentacyclo[17.3.1.13,6.113,17.04,8]pentacosa-1(23),13(24),14,16,19,21-hexaene-25-carboxamide |
| SMILES | NC(=O)[C@H]1[C@H]2C[C@H]3CCCC(O)c4cccc(c4)Nc4ncc(F)c(n4)N[C@@H]1[C@@H]3C2 |
| InChI | InChI=1S/C22H26FN5O2/c23-16-10-25-22-26-14-5-1-4-12(8-14)17(29)6-2-3-11-7-13-9-15(11)19(18(13)20(24)30)27-21(16)28-22/h1,4-5,8,10-11,13,15,17-19,29H,2-3,6-7,9H2,(H2,24,30)(H2,25,26,27,28)/t11-,13+,15-,17?,18+,19-/m1/s1 |
| InChIKey | YHOZNICNTFLNJW-KXLXQXLVSA-N |
| XLogP | 3.11 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |