C21H26FN5O4 — CID 45279327
(9R,10S,11R,13S)-11-ethyl-6-fluoro-14,15-dihydroxy-17-oxa-2,4,8,23-tetrazatetracyclo[16.3.1.13,7.09,13]tricosa-1(22),3,5,7(23),18,20-hexaene-10-carboxamide (PubChem CID 45279327) has the molecular formula C21H26FN5O4 and a molecular weight of 431.47 g/mol. Its IUPAC name is (9R,10S,11R,13S)-11-ethyl-6-fluoro-14,15-dihydroxy-17-oxa-2,4,8,23-tetrazatetracyclo[16.3.1.13,7.09,13]tricosa-1(22),3,5,7(23),18,20-hexaene-10-carboxamide.
| Compound Name | (9R,10S,11R,13S)-11-ethyl-6-fluoro-14,15-dihydroxy-17-oxa-2,4,8,23-tetrazatetracyclo[16.3.1.13,7.09,13]tricosa-1(22),3,5,7(23),18,20-hexaene-10-carboxamide |
|---|---|
| PubChem CID | 45279327 |
| Molecular Formula | C21H26FN5O4 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (9R,10S,11R,13S)-11-ethyl-6-fluoro-14,15-dihydroxy-17-oxa-2,4,8,23-tetrazatetracyclo[16.3.1.13,7.09,13]tricosa-1(22),3,5,7(23),18,20-hexaene-10-carboxamide |
| SMILES | CC[C@@H]1C[C@@H]2C(O)C(O)COc3cccc(c3)Nc3ncc(F)c(n3)N[C@H]2[C@H]1C(N)=O |
| InChI | InChI=1S/C21H26FN5O4/c1-2-10-6-13-17(16(10)19(23)30)26-20-14(22)8-24-21(27-20)25-11-4-3-5-12(7-11)31-9-15(28)18(13)29/h3-5,7-8,10,13,15-18,28-29H,2,6,9H2,1H3,(H2,23,30)(H2,24,25,26,27)/t10-,13+,15?,16+,17-,18?/m1/s1 |
| InChIKey | ZTDHGUTZHIZVHZ-QPCQXQAWSA-N |
| XLogP | 1.40 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |