C29H27N3O4 — CID 90361042
2-[1-[2-[2-[[(2Z)-1-aminopenta-2,4-dienyl]amino]-2-oxoethoxy]naphthalen-1-yl]naphthalen-2-yl]oxyacetamide (PubChem CID 90361042) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-[1-[2-[2-[[(2Z)-1-aminopenta-2,4-dienyl]amino]-2-oxoethoxy]naphthalen-1-yl]naphthalen-2-yl]oxyacetamide.
| Compound Name | 2-[1-[2-[2-[[(2Z)-1-aminopenta-2,4-dienyl]amino]-2-oxoethoxy]naphthalen-1-yl]naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 90361042 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-[1-[2-[2-[[(2Z)-1-aminopenta-2,4-dienyl]amino]-2-oxoethoxy]naphthalen-1-yl]naphthalen-2-yl]oxyacetamide |
| SMILES | C=C/C=C\C(N)NC(=O)COc1ccc2ccccc2c1-c1c(OCC(N)=O)ccc2ccccc12 |
| InChI | InChI=1S/C29H27N3O4/c1-2-3-12-25(30)32-27(34)18-36-24-16-14-20-9-5-7-11-22(20)29(24)28-21-10-6-4-8-19(21)13-15-23(28)35-17-26(31)33/h2-16,25H,1,17-18,30H2,(H2,31,33)(H,32,34)/b12-3- |
| InChIKey | ZYGLHVQBFMOBDC-BASWHVEKSA-N |
| XLogP | 4.05 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|