C9H11NS — CID 90364000
2,5-dimethyl-4,5-dihydrothieno[2,3-c]pyridine (PubChem CID 90364000) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 2,5-dimethyl-4,5-dihydrothieno[2,3-c]pyridine.
| Compound Name | 2,5-dimethyl-4,5-dihydrothieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 90364000 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2,5-dimethyl-4,5-dihydrothieno[2,3-c]pyridine |
| SMILES | Cc1cc2c(s1)C=NC(C)C2 |
| InChI | InChI=1S/C9H11NS/c1-6-3-8-4-7(2)11-9(8)5-10-6/h4-6H,3H2,1-2H3 |
| InChIKey | OOAOORWIROCTHE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |