C8H9NS — CID 57423976
7-methyl-4,5-dihydrothieno[2,3-c]pyridine (PubChem CID 57423976) has the molecular formula C8H9NS and a molecular weight of 151.23 g/mol. Its IUPAC name is 7-methyl-4,5-dihydrothieno[2,3-c]pyridine.
| Compound Name | 7-methyl-4,5-dihydrothieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 57423976 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 7-methyl-4,5-dihydrothieno[2,3-c]pyridine |
| SMILES | CC1=NCCc2ccsc21 |
| InChI | InChI=1S/C8H9NS/c1-6-8-7(2-4-9-6)3-5-10-8/h3,5H,2,4H2,1H3 |
| InChIKey | QNWYGZSYCSFXOO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |