About 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine
4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine (PubChem CID 89010854) has the molecular formula C8H8FNS
and a molecular weight of 169.22 g/mol. Its IUPAC name is 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine.
Analyze 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine?
The IUPAC name of 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine (CID 89010854) is 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine.
What is the SMILES notation for 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine?
The canonical SMILES for 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine is FCC1=NCCc2sccc21.
What is the InChIKey of 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine?
The InChIKey is WPBQZPNIHITKQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNS/c9-5-7-6-2-4-11-8(6)1-3-10-7/h2,4H,1,3,5H2.
What are the key properties of 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine?
4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine has a molecular weight of 169.22 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(fluoromethyl)-6,7-dihydrothieno[3,2-c]pyridine is sourced from PubChem (CID 89010854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).