C31H37ClN6O5 — CID 90368546
N-[3-[[(3S)-2-amino-1-(1-aminoethyl)-5-(4-chlorophenyl)-3-[2-(ethylamino)-2-oxoethyl]-2,3-dihydro-1,4-benzodiazepin-7-yl]oxy]propyl]-3,4-dihydroxybenzamide (PubChem CID 90368546) has the molecular formula C31H37ClN6O5 and a molecular weight of 609.13 g/mol. Its IUPAC name is N-[3-[[(3S)-2-amino-1-(1-aminoethyl)-5-(4-chlorophenyl)-3-[2-(ethylamino)-2-oxoethyl]-2,3-dihydro-1,4-benzodiazepin-7-yl]oxy]propyl]-3,4-dihydroxybenzamide.
| Compound Name | N-[3-[[(3S)-2-amino-1-(1-aminoethyl)-5-(4-chlorophenyl)-3-[2-(ethylamino)-2-oxoethyl]-2,3-dihydro-1,4-benzodiazepin-7-yl]oxy]propyl]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 90368546 |
| Molecular Formula | C31H37ClN6O5 |
| Molecular Weight | 609.13 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | N-[3-[[(3S)-2-amino-1-(1-aminoethyl)-5-(4-chlorophenyl)-3-[2-(ethylamino)-2-oxoethyl]-2,3-dihydro-1,4-benzodiazepin-7-yl]oxy]propyl]-3,4-dihydroxybenzamide |
| SMILES | CCNC(=O)C[C@@H]1N=C(c2ccc(Cl)cc2)c2cc(OCCCNC(=O)c3ccc(O)c(O)c3)ccc2N(C(C)N)C1N |
| InChI | InChI=1S/C31H37ClN6O5/c1-3-35-28(41)17-24-30(34)38(18(2)33)25-11-10-22(16-23(25)29(37-24)19-5-8-21(32)9-6-19)43-14-4-13-36-31(42)20-7-12-26(39)27(40)15-20/h5-12,15-16,18,24,30,39-40H,3-4,13-14,17,33-34H2,1-2H3,(H,35,41)(H,36,42)/t18?,24-,30?/m0/s1 |
| InChIKey | GQXSXIAOTCTSNK-DPXQPOCBSA-N |
| XLogP | 3.09 |
| TPSA | 175.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|