C18H26O7S — CID 90369754
methyl (E)-3-[(2R)-1-butoxy-3-(4-methylphenyl)sulfonyloxypropan-2-yl]oxyprop-2-enoate (PubChem CID 90369754) has the molecular formula C18H26O7S and a molecular weight of 386.47 g/mol. Its IUPAC name is methyl (E)-3-[(2R)-1-butoxy-3-(4-methylphenyl)sulfonyloxypropan-2-yl]oxyprop-2-enoate.
| Compound Name | methyl (E)-3-[(2R)-1-butoxy-3-(4-methylphenyl)sulfonyloxypropan-2-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 90369754 |
| Molecular Formula | C18H26O7S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | methyl (E)-3-[(2R)-1-butoxy-3-(4-methylphenyl)sulfonyloxypropan-2-yl]oxyprop-2-enoate |
| SMILES | CCCCOC[C@H](COS(=O)(=O)c1ccc(C)cc1)O/C=C/C(=O)OC |
| InChI | InChI=1S/C18H26O7S/c1-4-5-11-23-13-16(24-12-10-18(19)22-3)14-25-26(20,21)17-8-6-15(2)7-9-17/h6-10,12,16H,4-5,11,13-14H2,1-3H3/b12-10+/t16-/m1/s1 |
| InChIKey | PZLDPZJJKRXHTL-YBHKSSGVSA-N |
| XLogP | 2.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|