C20H28N2O8 — CID 90373762
1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 4-[(3-methylbut-2-enoylamino)methyl]cyclohexane-1-carboxylate (PubChem CID 90373762) has the molecular formula C20H28N2O8 and a molecular weight of 424.45 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 4-[(3-methylbut-2-enoylamino)methyl]cyclohexane-1-carboxylate.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 4-[(3-methylbut-2-enoylamino)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90373762 |
| Molecular Formula | C20H28N2O8 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 4-[(3-methylbut-2-enoylamino)methyl]cyclohexane-1-carboxylate |
| SMILES | CC(C)=CC(=O)NCC1CCC(C(=O)OC(C)OC(=O)ON2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C20H28N2O8/c1-12(2)10-16(23)21-11-14-4-6-15(7-5-14)19(26)28-13(3)29-20(27)30-22-17(24)8-9-18(22)25/h10,13-15H,4-9,11H2,1-3H3,(H,21,23) |
| InChIKey | NZHTVFYVFAQDJP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|