C7H14Cl4N2O2 — CID 90374902
trimethyl-[2-[(2,2,2-trichloroacetyl)amino]oxyethyl]azanium chloride (PubChem CID 90374902) has the molecular formula C7H14Cl4N2O2 and a molecular weight of 300.01 g/mol. Its IUPAC name is trimethyl-[2-[(2,2,2-trichloroacetyl)amino]oxyethyl]azanium chloride.
| Compound Name | trimethyl-[2-[(2,2,2-trichloroacetyl)amino]oxyethyl]azanium chloride |
|---|---|
| PubChem CID | 90374902 |
| Molecular Formula | C7H14Cl4N2O2 |
| Molecular Weight | 300.01 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | trimethyl-[2-[(2,2,2-trichloroacetyl)amino]oxyethyl]azanium chloride |
| SMILES | C[N+](C)(C)CCONC(=O)C(Cl)(Cl)Cl.[Cl-] |
| InChI | InChI=1S/C7H13Cl3N2O2.ClH/c1-12(2,3)4-5-14-11-6(13)7(8,9)10;/h4-5H2,1-3H3;1H |
| InChIKey | BGLWDYRRRJJTRB-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.01 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|