C19H19NO7 — CID 90376510
[4-(1,9-dihydroxy-6-oxobenzo[c]chromen-3-yl)-4-methylpentyl] nitrate (PubChem CID 90376510) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is [4-(1,9-dihydroxy-6-oxobenzo[c]chromen-3-yl)-4-methylpentyl] nitrate.
| Compound Name | [4-(1,9-dihydroxy-6-oxobenzo[c]chromen-3-yl)-4-methylpentyl] nitrate |
|---|---|
| PubChem CID | 90376510 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | [4-(1,9-dihydroxy-6-oxobenzo[c]chromen-3-yl)-4-methylpentyl] nitrate |
| SMILES | CC(C)(CCCO[N+](=O)[O-])c1cc(O)c2c(c1)oc(=O)c1ccc(O)cc12 |
| InChI | InChI=1S/C19H19NO7/c1-19(2,6-3-7-26-20(24)25)11-8-15(22)17-14-10-12(21)4-5-13(14)18(23)27-16(17)9-11/h4-5,8-10,21-22H,3,6-7H2,1-2H3 |
| InChIKey | KAPKLJMMFQRJTK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|