C21H31NO6 — CID 144692649
[7-[3,5-dihydroxy-4-(3-oxocyclohexyl)phenyl]-7-methyloctyl] nitrate (PubChem CID 144692649) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is [7-[3,5-dihydroxy-4-(3-oxocyclohexyl)phenyl]-7-methyloctyl] nitrate.
| Compound Name | [7-[3,5-dihydroxy-4-(3-oxocyclohexyl)phenyl]-7-methyloctyl] nitrate |
|---|---|
| PubChem CID | 144692649 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | [7-[3,5-dihydroxy-4-(3-oxocyclohexyl)phenyl]-7-methyloctyl] nitrate |
| SMILES | CC(C)(CCCCCCO[N+](=O)[O-])c1cc(O)c(C2CCCC(=O)C2)c(O)c1 |
| InChI | InChI=1S/C21H31NO6/c1-21(2,10-5-3-4-6-11-28-22(26)27)16-13-18(24)20(19(25)14-16)15-8-7-9-17(23)12-15/h13-15,24-25H,3-12H2,1-2H3 |
| InChIKey | WNPFNXLHTFFWCZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|