About N-benzyl-N,1-dipropylcyclopropan-1-amine
N-benzyl-N,1-dipropylcyclopropan-1-amine (PubChem CID 90378697) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is N-benzyl-N,1-dipropylcyclopropan-1-amine.
Molecular Properties
| Compound Name | N-benzyl-N,1-dipropylcyclopropan-1-amine |
| PubChem CID | 90378697 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-benzyl-N,1-dipropylcyclopropan-1-amine |
| SMILES | CCCN(Cc1ccccc1)C1(CCC)CC1 |
| InChI | InChI=1S/C16H25N/c1-3-10-16(11-12-16)17(13-4-2)14-15-8-6-5-7-9-15/h5-9H,3-4,10-14H2,1-2H3 |
| InChIKey | SWPGGKRQDLJUTH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-N,1-dipropylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N,1-dipropylcyclopropan-1-amine?
The IUPAC name of N-benzyl-N,1-dipropylcyclopropan-1-amine (CID 90378697) is N-benzyl-N,1-dipropylcyclopropan-1-amine.
What is the SMILES notation for N-benzyl-N,1-dipropylcyclopropan-1-amine?
The canonical SMILES for N-benzyl-N,1-dipropylcyclopropan-1-amine is CCCN(Cc1ccccc1)C1(CCC)CC1.
What is the InChIKey of N-benzyl-N,1-dipropylcyclopropan-1-amine?
The InChIKey is SWPGGKRQDLJUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N/c1-3-10-16(11-12-16)17(13-4-2)14-15-8-6-5-7-9-15/h5-9H,3-4,10-14H2,1-2H3.
What are the key properties of N-benzyl-N,1-dipropylcyclopropan-1-amine?
N-benzyl-N,1-dipropylcyclopropan-1-amine has a molecular weight of 231.38 g/mol, XLogP of 4.23, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N,1-dipropylcyclopropan-1-amine is sourced from PubChem (CID 90378697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).