C15H14FN5OS — CID 90381573
N-(5-cyclopropyl-1H-pyrazol-3-yl)-5-fluoro-2-(4-hydroxysulfanylcyclopenta-1,3-dien-1-yl)pyrimidin-4-amine (PubChem CID 90381573) has the molecular formula C15H14FN5OS and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(5-cyclopropyl-1H-pyrazol-3-yl)-5-fluoro-2-(4-hydroxysulfanylcyclopenta-1,3-dien-1-yl)pyrimidin-4-amine.
| Compound Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-5-fluoro-2-(4-hydroxysulfanylcyclopenta-1,3-dien-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 90381573 |
| Molecular Formula | C15H14FN5OS |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-5-fluoro-2-(4-hydroxysulfanylcyclopenta-1,3-dien-1-yl)pyrimidin-4-amine |
| SMILES | OSC1=CC=C(c2ncc(F)c(Nc3cc(C4CC4)[nH]n3)n2)C1 |
| InChI | InChI=1S/C15H14FN5OS/c16-11-7-17-14(9-3-4-10(5-9)23-22)19-15(11)18-13-6-12(20-21-13)8-1-2-8/h3-4,6-8,22H,1-2,5H2,(H2,17,18,19,20,21) |
| InChIKey | URJNGFOYVBVQKN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|