C23H32N3O2S+ — CID 9039366
[2-(2-benzylsulfanylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium (PubChem CID 9039366) has the molecular formula C23H32N3O2S+ and a molecular weight of 414.60 g/mol. Its IUPAC name is [2-(2-benzylsulfanylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium.
| Compound Name | [2-(2-benzylsulfanylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium |
|---|---|
| PubChem CID | 9039366 |
| Molecular Formula | C23H32N3O2S+ |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [2-(2-benzylsulfanylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium |
| SMILES | CC[NH+](CC(=O)Nc1ccccc1SCc1ccccc1)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H31N3O2S/c1-5-26(16-22(28)25-23(2,3)4)15-21(27)24-19-13-9-10-14-20(19)29-17-18-11-7-6-8-12-18/h6-14H,5,15-17H2,1-4H3,(H,24,27)(H,25,28)/p+1 |
| InChIKey | FRRKPYCCNXZZAA-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |