C45H38O4 — CID 90396467
2-[2,8-bis(9,9-dimethylfluoren-2-yl)-7-methoxydibenzofuran-3-yl]oxyethanol (PubChem CID 90396467) has the molecular formula C45H38O4 and a molecular weight of 642.79 g/mol. Its IUPAC name is 2-[2,8-bis(9,9-dimethylfluoren-2-yl)-7-methoxydibenzofuran-3-yl]oxyethanol.
| Compound Name | 2-[2,8-bis(9,9-dimethylfluoren-2-yl)-7-methoxydibenzofuran-3-yl]oxyethanol |
|---|---|
| PubChem CID | 90396467 |
| Molecular Formula | C45H38O4 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2-[2,8-bis(9,9-dimethylfluoren-2-yl)-7-methoxydibenzofuran-3-yl]oxyethanol |
| SMILES | COc1cc2oc3cc(OCCO)c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3c2cc1-c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C45H38O4/c1-44(2)36-12-8-6-10-28(36)30-16-14-26(20-38(30)44)32-22-34-35-23-33(41(48-19-18-46)25-43(35)49-42(34)24-40(32)47-5)27-15-17-31-29-11-7-9-13-37(29)45(3,4)39(31)21-27/h6-17,20-25,46H,18-19H2,1-5H3 |
| InChIKey | OXYARXVSTTWWIB-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |